C31H22N4S+2 — CID 170671489
2-[3-(3-methylbenzimidazole-1,3-diium-1-yl)phenyl]sulfanyl-9-pyridin-2-ylcarbazole (PubChem CID 170671489) has the molecular formula C31H22N4S+2 and a molecular weight of 482.61 g/mol. Its IUPAC name is 2-[3-(3-methylbenzimidazole-1,3-diium-1-yl)phenyl]sulfanyl-9-pyridin-2-ylcarbazole.
| Compound Name | 2-[3-(3-methylbenzimidazole-1,3-diium-1-yl)phenyl]sulfanyl-9-pyridin-2-ylcarbazole |
|---|---|
| PubChem CID | 170671489 |
| Molecular Formula | C31H22N4S+2 |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | 2-[3-(3-methylbenzimidazole-1,3-diium-1-yl)phenyl]sulfanyl-9-pyridin-2-ylcarbazole |
| SMILES | C[N+]1=C=[N+](c2cccc(Sc3ccc4c5ccccc5n(-c5ccccn5)c4c3)c2)c2ccccc21 |
| InChI | InChI=1S/C31H22N4S/c1-33-21-34(29-14-5-4-13-28(29)33)22-9-8-10-23(19-22)36-24-16-17-26-25-11-2-3-12-27(25)35(30(26)20-24)31-15-6-7-18-32-31/h2-20H,1H3/q+2 |
| InChIKey | WFRLXRIRDLVXER-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 23.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|