C37H36N4Si+2 — CID 170671406
[3-tert-butyl-5-(3-methylbenzimidazole-1,3-diium-1-yl)phenyl]-dimethyl-(9-pyridin-2-ylcarbazol-2-yl)silane (PubChem CID 170671406) has the molecular formula C37H36N4Si+2 and a molecular weight of 564.81 g/mol. Its IUPAC name is [3-tert-butyl-5-(3-methylbenzimidazole-1,3-diium-1-yl)phenyl]-dimethyl-(9-pyridin-2-ylcarbazol-2-yl)silane.
| Compound Name | [3-tert-butyl-5-(3-methylbenzimidazole-1,3-diium-1-yl)phenyl]-dimethyl-(9-pyridin-2-ylcarbazol-2-yl)silane |
|---|---|
| PubChem CID | 170671406 |
| Molecular Formula | C37H36N4Si+2 |
| Molecular Weight | 564.81 g/mol |
| Exact Mass | 564.27 |
| IUPAC Name | [3-tert-butyl-5-(3-methylbenzimidazole-1,3-diium-1-yl)phenyl]-dimethyl-(9-pyridin-2-ylcarbazol-2-yl)silane |
| SMILES | C[N+]1=C=[N+](c2cc(C(C)(C)C)cc([Si](C)(C)c3ccc4c5ccccc5n(-c5ccccn5)c4c3)c2)c2ccccc21 |
| InChI | InChI=1S/C37H36N4Si/c1-37(2,3)26-21-27(40-25-39(4)33-15-9-10-16-34(33)40)23-29(22-26)42(5,6)28-18-19-31-30-13-7-8-14-32(30)41(35(31)24-28)36-17-11-12-20-38-36/h7-24H,1-6H3/q+2 |
| InChIKey | LHFLOAAESDISMQ-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 23.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.81 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|