C58H55N7O+2 — CID 168799785
3-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]-2-[3-tert-butyl-5-(3-methylbenzimidazole-1,3-diium-1-yl)phenoxy]-9-pyridin-2-ylcarbazole (PubChem CID 168799785) has the molecular formula C58H55N7O+2 and a molecular weight of 866.13 g/mol. Its IUPAC name is 3-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]-2-[3-tert-butyl-5-(3-methylbenzimidazole-1,3-diium-1-yl)phenoxy]-9-pyridin-2-ylcarbazole.
| Compound Name | 3-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]-2-[3-tert-butyl-5-(3-methylbenzimidazole-1,3-diium-1-yl)phenoxy]-9-pyridin-2-ylcarbazole |
|---|---|
| PubChem CID | 168799785 |
| Molecular Formula | C58H55N7O+2 |
| Molecular Weight | 866.13 g/mol |
| Exact Mass | 865.45 |
| IUPAC Name | 3-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]-2-[3-tert-butyl-5-(3-methylbenzimidazole-1,3-diium-1-yl)phenoxy]-9-pyridin-2-ylcarbazole |
| SMILES | C[N+]1=C=[N+](c2cc(Oc3cc4c(cc3-c3nc(-c5ccc(C(C)(C)C)cc5)nc(-c5ccc(C(C)(C)C)cc5)n3)c3ccccc3n4-c3ccccn3)cc(C(C)(C)C)c2)c2ccccc21 |
| InChI | InChI=1S/C58H55N7O/c1-56(2,3)39-26-22-37(23-27-39)53-60-54(38-24-28-40(29-25-38)57(4,5)6)62-55(61-53)46-34-45-44-17-11-12-18-47(44)65(52-21-15-16-30-59-52)50(45)35-51(46)66-43-32-41(58(7,8)9)31-42(33-43)64-36-63(10)48-19-13-14-20-49(48)64/h11-35H,1-10H3/q+2 |
| InChIKey | ZOZZFPICYFXUJQ-UHFFFAOYSA-N |
| XLogP | 14.35 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.13 |
| LogP ≤ 5 | 14.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|