C50H47N7O+2 — CID 168799546
3-(4,6-ditert-butyl-1,3,5-triazin-2-yl)-9-pyridin-2-yl-2-[3-[3-(3,4,5-trimethylphenyl)benzimidazole-1,3-diium-1-yl]phenoxy]carbazole (PubChem CID 168799546) has the molecular formula C50H47N7O+2 and a molecular weight of 761.97 g/mol. Its IUPAC name is 3-(4,6-ditert-butyl-1,3,5-triazin-2-yl)-9-pyridin-2-yl-2-[3-[3-(3,4,5-trimethylphenyl)benzimidazole-1,3-diium-1-yl]phenoxy]carbazole.
| Compound Name | 3-(4,6-ditert-butyl-1,3,5-triazin-2-yl)-9-pyridin-2-yl-2-[3-[3-(3,4,5-trimethylphenyl)benzimidazole-1,3-diium-1-yl]phenoxy]carbazole |
|---|---|
| PubChem CID | 168799546 |
| Molecular Formula | C50H47N7O+2 |
| Molecular Weight | 761.97 g/mol |
| Exact Mass | 761.38 |
| IUPAC Name | 3-(4,6-ditert-butyl-1,3,5-triazin-2-yl)-9-pyridin-2-yl-2-[3-[3-(3,4,5-trimethylphenyl)benzimidazole-1,3-diium-1-yl]phenoxy]carbazole |
| SMILES | Cc1cc([N+]2=C=[N+](c3cccc(Oc4cc5c(cc4-c4nc(C(C)(C)C)nc(C(C)(C)C)n4)c4ccccc4n5-c4ccccn4)c3)c3ccccc32)cc(C)c1C |
| InChI | InChI=1S/C50H47N7O/c1-31-25-35(26-32(2)33(31)3)56-30-55(41-21-12-13-22-42(41)56)34-17-16-18-36(27-34)58-44-29-43-38(37-19-10-11-20-40(37)57(43)45-23-14-15-24-51-45)28-39(44)46-52-47(49(4,5)6)54-48(53-46)50(7,8)9/h10-29H,1-9H3/q+2 |
| InChIKey | OMVKFJSHDSQVIG-UHFFFAOYSA-N |
| XLogP | 12.20 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.97 |
| LogP ≤ 5 | 12.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|