C50H35N7OPt+2 — CID 168799780
3-(4,6-diphenyl-1,3,5-triazin-2-yl)-9-pyridin-2-yl-2-[3-[3-(3,4,5-trimethylphenyl)imidazole-1,3-diium-1-yl]benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum(2+) (PubChem CID 168799780) has the molecular formula C50H35N7OPt+2 and a molecular weight of 944.96 g/mol. Its IUPAC name is 3-(4,6-diphenyl-1,3,5-triazin-2-yl)-9-pyridin-2-yl-2-[3-[3-(3,4,5-trimethylphenyl)imidazole-1,3-diium-1-yl]benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum(2+).
| Compound Name | 3-(4,6-diphenyl-1,3,5-triazin-2-yl)-9-pyridin-2-yl-2-[3-[3-(3,4,5-trimethylphenyl)imidazole-1,3-diium-1-yl]benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum(2+) |
|---|---|
| PubChem CID | 168799780 |
| Molecular Formula | C50H35N7OPt+2 |
| Molecular Weight | 944.96 g/mol |
| Exact Mass | 944.25 |
| IUPAC Name | 3-(4,6-diphenyl-1,3,5-triazin-2-yl)-9-pyridin-2-yl-2-[3-[3-(3,4,5-trimethylphenyl)imidazole-1,3-diium-1-yl]benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum(2+) |
| SMILES | Cc1cc([N+]2=C=[N+](c3[c-]c(Oc4[c-]c5c(cc4-c4nc(-c6ccccc6)nc(-c6ccccc6)n4)c4ccccc4n5-c4ccccn4)ccc3)C=C2)cc(C)c1C.[Pt+2] |
| InChI | InChI=1S/C50H35N7O.Pt/c1-33-27-39(28-34(2)35(33)3)56-26-25-55(32-56)38-19-14-20-40(29-38)58-46-31-45-42(41-21-10-11-22-44(41)57(45)47-23-12-13-24-51-47)30-43(46)50-53-48(36-15-6-4-7-16-36)52-49(54-50)37-17-8-5-9-18-37;/h4-28,30H,1-3H3;/q;+2 |
| InChIKey | NUVHFMWQNJUJIT-UHFFFAOYSA-N |
| XLogP | 11.33 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 944.96 |
| LogP ≤ 5 | 11.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|