C56H40N4OPt+2 — CID 164731512
1-(4-tert-butyl-2,6-diphenylphenyl)-3-[3-[(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)oxy]benzene-2-id-1-yl]benzo[e]benzimidazole-1,3-diium;platinum(2+) (PubChem CID 164731512) has the molecular formula C56H40N4OPt+2 and a molecular weight of 980.04 g/mol. Its IUPAC name is 1-(4-tert-butyl-2,6-diphenylphenyl)-3-[3-[(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)oxy]benzene-2-id-1-yl]benzo[e]benzimidazole-1,3-diium;platinum(2+).
| Compound Name | 1-(4-tert-butyl-2,6-diphenylphenyl)-3-[3-[(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)oxy]benzene-2-id-1-yl]benzo[e]benzimidazole-1,3-diium;platinum(2+) |
|---|---|
| PubChem CID | 164731512 |
| Molecular Formula | C56H40N4OPt+2 |
| Molecular Weight | 980.04 g/mol |
| Exact Mass | 979.28 |
| IUPAC Name | 1-(4-tert-butyl-2,6-diphenylphenyl)-3-[3-[(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)oxy]benzene-2-id-1-yl]benzo[e]benzimidazole-1,3-diium;platinum(2+) |
| SMILES | CC(C)(C)c1cc(-c2ccccc2)c([N+]2=C=[N+](c3[c-]c(Oc4[c-]c5c(cc4)c4ccccc4n5-c4ccccn4)ccc3)c3ccc4ccccc4c32)c(-c2ccccc2)c1.[Pt+2] |
| InChI | InChI=1S/C56H40N4O.Pt/c1-56(2,3)41-33-48(38-17-6-4-7-18-38)54(49(34-41)39-19-8-5-9-20-39)59-37-58(51-31-28-40-21-10-11-24-45(40)55(51)59)42-22-16-23-43(35-42)61-44-29-30-47-46-25-12-13-26-50(46)60(52(47)36-44)53-27-14-15-32-57-53;/h4-34H,1-3H3;/q;+2 |
| InChIKey | LRNSNGWACZSWKE-UHFFFAOYSA-N |
| XLogP | 14.21 |
| TPSA | 33.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 980.04 |
| LogP ≤ 5 | 14.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|