C51H31N5OPt+2 — CID 164731911
1-(2,6-diphenylphenyl)-3-[3-[(9-pyrimidin-2-yl-1H-carbazol-1-id-2-yl)oxy]benzene-2-id-1-yl]benzo[e]benzimidazole-1,3-diium;platinum(2+) (PubChem CID 164731911) has the molecular formula C51H31N5OPt+2 and a molecular weight of 924.92 g/mol. Its IUPAC name is 1-(2,6-diphenylphenyl)-3-[3-[(9-pyrimidin-2-yl-1H-carbazol-1-id-2-yl)oxy]benzene-2-id-1-yl]benzo[e]benzimidazole-1,3-diium;platinum(2+).
| Compound Name | 1-(2,6-diphenylphenyl)-3-[3-[(9-pyrimidin-2-yl-1H-carbazol-1-id-2-yl)oxy]benzene-2-id-1-yl]benzo[e]benzimidazole-1,3-diium;platinum(2+) |
|---|---|
| PubChem CID | 164731911 |
| Molecular Formula | C51H31N5OPt+2 |
| Molecular Weight | 924.92 g/mol |
| Exact Mass | 924.22 |
| IUPAC Name | 1-(2,6-diphenylphenyl)-3-[3-[(9-pyrimidin-2-yl-1H-carbazol-1-id-2-yl)oxy]benzene-2-id-1-yl]benzo[e]benzimidazole-1,3-diium;platinum(2+) |
| SMILES | C1=[N+](c2[c-]c(Oc3[c-]c4c(cc3)c3ccccc3n4-c3ncccn3)ccc2)c2ccc3ccccc3c2[N+]=1c1c(-c2ccccc2)cccc1-c1ccccc1.[Pt+2] |
| InChI | InChI=1S/C51H31N5O.Pt/c1-3-14-35(15-4-1)41-23-12-24-42(36-16-5-2-6-17-36)49(41)55-34-54(47-29-26-37-18-7-8-21-43(37)50(47)55)38-19-11-20-39(32-38)57-40-27-28-45-44-22-9-10-25-46(44)56(48(45)33-40)51-52-30-13-31-53-51;/h1-31H;/q;+2 |
| InChIKey | OGNKGUNERPBPIL-UHFFFAOYSA-N |
| XLogP | 12.31 |
| TPSA | 45.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 924.92 |
| LogP ≤ 5 | 12.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|