C51H31N5OPd+2 — CID 164731908
7-[3-[1-(2,6-diphenylphenyl)benzo[e]benzimidazole-1,3-diium-3-yl]benzene-2-id-1-yl]oxy-5-pyridin-2-yl-6H-pyrido[4,3-b]indol-6-ide;palladium(2+) (PubChem CID 164731908) has the molecular formula C51H31N5OPd+2 and a molecular weight of 836.26 g/mol. Its IUPAC name is 7-[3-[1-(2,6-diphenylphenyl)benzo[e]benzimidazole-1,3-diium-3-yl]benzene-2-id-1-yl]oxy-5-pyridin-2-yl-6H-pyrido[4,3-b]indol-6-ide;palladium(2+).
| Compound Name | 7-[3-[1-(2,6-diphenylphenyl)benzo[e]benzimidazole-1,3-diium-3-yl]benzene-2-id-1-yl]oxy-5-pyridin-2-yl-6H-pyrido[4,3-b]indol-6-ide;palladium(2+) |
|---|---|
| PubChem CID | 164731908 |
| Molecular Formula | C51H31N5OPd+2 |
| Molecular Weight | 836.26 g/mol |
| Exact Mass | 835.16 |
| IUPAC Name | 7-[3-[1-(2,6-diphenylphenyl)benzo[e]benzimidazole-1,3-diium-3-yl]benzene-2-id-1-yl]oxy-5-pyridin-2-yl-6H-pyrido[4,3-b]indol-6-ide;palladium(2+) |
| SMILES | C1=[N+](c2[c-]c(Oc3[c-]c4c(cc3)c3cnccc3n4-c3ccccn3)ccc2)c2ccc3ccccc3c2[N+]=1c1c(-c2ccccc2)cccc1-c1ccccc1.[Pd+2] |
| InChI | InChI=1S/C51H31N5O.Pd/c1-3-13-35(14-4-1)41-21-12-22-42(36-15-5-2-6-16-36)50(41)55-34-54(47-27-24-37-17-7-8-20-43(37)51(47)55)38-18-11-19-39(31-38)57-40-25-26-44-45-33-52-30-28-46(45)56(48(44)32-40)49-23-9-10-29-53-49;/h1-30,33H;/q;+2 |
| InChIKey | PRGQEVYUMOHJFD-UHFFFAOYSA-N |
| XLogP | 12.31 |
| TPSA | 45.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.26 |
| LogP ≤ 5 | 12.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|