C50H30N6OPt+2 — CID 164731898
1-(2,6-diphenylphenyl)-3-[3-[[9-(1,3,5-triazin-2-yl)-1H-carbazol-1-id-2-yl]oxy]benzene-2-id-1-yl]benzo[e]benzimidazole-1,3-diium;platinum(2+) (PubChem CID 164731898) has the molecular formula C50H30N6OPt+2 and a molecular weight of 925.91 g/mol. Its IUPAC name is 1-(2,6-diphenylphenyl)-3-[3-[[9-(1,3,5-triazin-2-yl)-1H-carbazol-1-id-2-yl]oxy]benzene-2-id-1-yl]benzo[e]benzimidazole-1,3-diium;platinum(2+).
| Compound Name | 1-(2,6-diphenylphenyl)-3-[3-[[9-(1,3,5-triazin-2-yl)-1H-carbazol-1-id-2-yl]oxy]benzene-2-id-1-yl]benzo[e]benzimidazole-1,3-diium;platinum(2+) |
|---|---|
| PubChem CID | 164731898 |
| Molecular Formula | C50H30N6OPt+2 |
| Molecular Weight | 925.91 g/mol |
| Exact Mass | 925.21 |
| IUPAC Name | 1-(2,6-diphenylphenyl)-3-[3-[[9-(1,3,5-triazin-2-yl)-1H-carbazol-1-id-2-yl]oxy]benzene-2-id-1-yl]benzo[e]benzimidazole-1,3-diium;platinum(2+) |
| SMILES | C1=[N+](c2[c-]c(Oc3[c-]c4c(cc3)c3ccccc3n4-c3ncncn3)ccc2)c2ccc3ccccc3c2[N+]=1c1c(-c2ccccc2)cccc1-c1ccccc1.[Pt+2] |
| InChI | InChI=1S/C50H30N6O.Pt/c1-3-13-34(14-4-1)40-22-12-23-41(35-15-5-2-6-16-35)48(40)55-33-54(46-28-25-36-17-7-8-20-42(36)49(46)55)37-18-11-19-38(29-37)57-39-26-27-44-43-21-9-10-24-45(43)56(47(44)30-39)50-52-31-51-32-53-50;/h1-28,31-32H;/q;+2 |
| InChIKey | UIMQHZDBDXQOHD-UHFFFAOYSA-N |
| XLogP | 11.70 |
| TPSA | 58.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 925.91 |
| LogP ≤ 5 | 11.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|