C21H21F3N8O3 — CID 156678535
3-[5-[cyano(trifluoromethyl)amino]-2-pyridinyl]-1-[6-formyl-5-[(4-methyl-2-oxopiperazin-1-yl)methyl]-2-pyridinyl]-1-methylurea (PubChem CID 156678535) has the molecular formula C21H21F3N8O3 and a molecular weight of 490.45 g/mol. Its IUPAC name is 3-[5-[cyano(trifluoromethyl)amino]-2-pyridinyl]-1-[6-formyl-5-[(4-methyl-2-oxopiperazin-1-yl)methyl]-2-pyridinyl]-1-methylurea.
| Compound Name | 3-[5-[cyano(trifluoromethyl)amino]-2-pyridinyl]-1-[6-formyl-5-[(4-methyl-2-oxopiperazin-1-yl)methyl]-2-pyridinyl]-1-methylurea |
|---|---|
| PubChem CID | 156678535 |
| Molecular Formula | C21H21F3N8O3 |
| Molecular Weight | 490.45 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 3-[5-[cyano(trifluoromethyl)amino]-2-pyridinyl]-1-[6-formyl-5-[(4-methyl-2-oxopiperazin-1-yl)methyl]-2-pyridinyl]-1-methylurea |
| SMILES | CN1CCN(Cc2ccc(N(C)C(=O)Nc3ccc(N(C#N)C(F)(F)F)cn3)nc2C=O)C(=O)C1 |
| InChI | InChI=1S/C21H21F3N8O3/c1-29-7-8-31(19(34)11-29)10-14-3-6-18(27-16(14)12-33)30(2)20(35)28-17-5-4-15(9-26-17)32(13-25)21(22,23)24/h3-6,9,12H,7-8,10-11H2,1-2H3,(H,26,28,35) |
| InChIKey | KDELDRBXHDJYLG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 125.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.45 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|