C17H15F3N4O6 — CID 156678549
[4-(2-aminoethylamino)-2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl] 2,2,2-trifluoroacetate (PubChem CID 156678549) has the molecular formula C17H15F3N4O6 and a molecular weight of 428.32 g/mol. Its IUPAC name is [4-(2-aminoethylamino)-2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl] 2,2,2-trifluoroacetate.
| Compound Name | [4-(2-aminoethylamino)-2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 156678549 |
| Molecular Formula | C17H15F3N4O6 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | [4-(2-aminoethylamino)-2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl] 2,2,2-trifluoroacetate |
| SMILES | NCCNc1c(OC(=O)C(F)(F)F)ccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C17H15F3N4O6/c18-17(19,20)16(29)30-9-3-1-7-11(12(9)22-6-5-21)15(28)24(14(7)27)8-2-4-10(25)23-13(8)26/h1,3,8,22H,2,4-6,21H2,(H,23,25,26) |
| InChIKey | HJHKVFWZIHTTOB-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|