C25H31F3N4O10 — CID 156811869
[4-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethylamino]-2-[(3S)-2,6-dioxopiperidin-3-yl]-1,3-dioxoisoindol-5-yl] 2,2,2-trifluoroacetate (PubChem CID 156811869) has the molecular formula C25H31F3N4O10 and a molecular weight of 604.54 g/mol. Its IUPAC name is [4-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethylamino]-2-[(3S)-2,6-dioxopiperidin-3-yl]-1,3-dioxoisoindol-5-yl] 2,2,2-trifluoroacetate.
| Compound Name | [4-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethylamino]-2-[(3S)-2,6-dioxopiperidin-3-yl]-1,3-dioxoisoindol-5-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 156811869 |
| Molecular Formula | C25H31F3N4O10 |
| Molecular Weight | 604.54 g/mol |
| Exact Mass | 604.20 |
| IUPAC Name | [4-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethylamino]-2-[(3S)-2,6-dioxopiperidin-3-yl]-1,3-dioxoisoindol-5-yl] 2,2,2-trifluoroacetate |
| SMILES | NCCOCCOCCOCCOCCNc1c(OC(=O)C(F)(F)F)ccc2c1C(=O)N([C@H]1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C25H31F3N4O10/c26-25(27,28)24(37)42-17-3-1-15-19(23(36)32(22(15)35)16-2-4-18(33)31-21(16)34)20(17)30-6-8-39-10-12-41-14-13-40-11-9-38-7-5-29/h1,3,16,30H,2,4-14,29H2,(H,31,33,34)/t16-/m0/s1 |
| InChIKey | QKVRCBSHYZWKSE-INIZCTEOSA-N |
| XLogP | -0.01 |
| TPSA | 184.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.54 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|