C20H36O4 — CID 156679583
4-[3-[(Z)-2-hydroxytridec-3-en-2-yl]oxiran-2-yl]-2-methylbutanoic acid (PubChem CID 156679583) has the molecular formula C20H36O4 and a molecular weight of 340.50 g/mol. Its IUPAC name is 4-[3-[(Z)-2-hydroxytridec-3-en-2-yl]oxiran-2-yl]-2-methylbutanoic acid.
| Compound Name | 4-[3-[(Z)-2-hydroxytridec-3-en-2-yl]oxiran-2-yl]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 156679583 |
| Molecular Formula | C20H36O4 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | 4-[3-[(Z)-2-hydroxytridec-3-en-2-yl]oxiran-2-yl]-2-methylbutanoic acid |
| SMILES | CCCCCCCCC/C=C\C(C)(O)C1OC1CCC(C)C(=O)O |
| InChI | InChI=1S/C20H36O4/c1-4-5-6-7-8-9-10-11-12-15-20(3,23)18-17(24-18)14-13-16(2)19(21)22/h12,15-18,23H,4-11,13-14H2,1-3H3,(H,21,22)/b15-12- |
| InChIKey | XZVXRMWTEANSMF-QINSGFPZSA-N |
| XLogP | 4.70 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|