C21H36O4 — CID 156679641
9-hydroxy-2,2,9-trimethyl-11-(3-pentyloxiran-2-yl)undec-10-ynoic acid (PubChem CID 156679641) has the molecular formula C21H36O4 and a molecular weight of 352.52 g/mol. Its IUPAC name is 9-hydroxy-2,2,9-trimethyl-11-(3-pentyloxiran-2-yl)undec-10-ynoic acid.
| Compound Name | 9-hydroxy-2,2,9-trimethyl-11-(3-pentyloxiran-2-yl)undec-10-ynoic acid |
|---|---|
| PubChem CID | 156679641 |
| Molecular Formula | C21H36O4 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | 9-hydroxy-2,2,9-trimethyl-11-(3-pentyloxiran-2-yl)undec-10-ynoic acid |
| SMILES | CCCCCC1OC1C#CC(C)(O)CCCCCCC(C)(C)C(=O)O |
| InChI | InChI=1S/C21H36O4/c1-5-6-9-12-17-18(25-17)13-16-21(4,24)15-11-8-7-10-14-20(2,3)19(22)23/h17-18,24H,5-12,14-15H2,1-4H3,(H,22,23) |
| InChIKey | CSOYSQVZXIPHMF-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|