C44H28O8S — CID 156680956
4-[4-[4-[4-[4-[4-(4-hydroxyphenyl)phenoxy]phenyl]sulfonylphenoxy]phenyl]phenyl]-2-benzofuran-1,3-dione (PubChem CID 156680956) has the molecular formula C44H28O8S and a molecular weight of 716.77 g/mol. Its IUPAC name is 4-[4-[4-[4-[4-[4-(4-hydroxyphenyl)phenoxy]phenyl]sulfonylphenoxy]phenyl]phenyl]-2-benzofuran-1,3-dione.
| Compound Name | 4-[4-[4-[4-[4-[4-(4-hydroxyphenyl)phenoxy]phenyl]sulfonylphenoxy]phenyl]phenyl]-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 156680956 |
| Molecular Formula | C44H28O8S |
| Molecular Weight | 716.77 g/mol |
| Exact Mass | 716.15 |
| IUPAC Name | 4-[4-[4-[4-[4-[4-(4-hydroxyphenyl)phenoxy]phenyl]sulfonylphenoxy]phenyl]phenyl]-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2c1cccc2-c1ccc(-c2ccc(Oc3ccc(S(=O)(=O)c4ccc(Oc5ccc(-c6ccc(O)cc6)cc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C44H28O8S/c45-33-14-8-29(9-15-33)31-12-18-35(19-13-31)51-37-22-26-39(27-23-37)53(48,49)38-24-20-36(21-25-38)50-34-16-10-30(11-17-34)28-4-6-32(7-5-28)40-2-1-3-41-42(40)44(47)52-43(41)46/h1-27,45H |
| InChIKey | YPVWPBADAKYJFE-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.77 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|