About dichloro(methylidene)ruthenium;methylazanide;propa-1,2-diene
dichloro(methylidene)ruthenium;methylazanide;propa-1,2-diene (PubChem CID 156682049) has the molecular formula C5H10Cl2NRu-
and a molecular weight of 256.12 g/mol. Its IUPAC name is dichloro(methylidene)ruthenium;methylazanide;propa-1,2-diene.
Molecular Properties
| Compound Name | dichloro(methylidene)ruthenium;methylazanide;propa-1,2-diene |
| PubChem CID | 156682049 |
| Molecular Formula | C5H10Cl2NRu- |
| Molecular Weight | 256.12 g/mol |
| Exact Mass | 255.92 |
| IUPAC Name | dichloro(methylidene)ruthenium;methylazanide;propa-1,2-diene |
| SMILES | C=C=C.C=[Ru](Cl)Cl.C[NH-] |
| InChI | InChI=1S/C3H4.CH4N.CH2.2ClH.Ru/c1-3-2;1-2;;;;/h1-2H2;2H,1H3;1H2;2*1H;/q;-1;;;;+2/p-2 |
| InChIKey | GRMNNCDNRLJDJD-UHFFFAOYSA-L |
| XLogP | 2.97 |
| TPSA | 23.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.12 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze dichloro(methylidene)ruthenium;methylazanide;propa-1,2-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro(methylidene)ruthenium;methylazanide;propa-1,2-diene?
The IUPAC name of dichloro(methylidene)ruthenium;methylazanide;propa-1,2-diene (CID 156682049) is dichloro(methylidene)ruthenium;methylazanide;propa-1,2-diene.
What is the SMILES notation for dichloro(methylidene)ruthenium;methylazanide;propa-1,2-diene?
The canonical SMILES for dichloro(methylidene)ruthenium;methylazanide;propa-1,2-diene is C=C=C.C=[Ru](Cl)Cl.C[NH-].
What is the InChIKey of dichloro(methylidene)ruthenium;methylazanide;propa-1,2-diene?
The InChIKey is GRMNNCDNRLJDJD-UHFFFAOYSA-L. The full InChI is InChI=1S/C3H4.CH4N.CH2.2ClH.Ru/c1-3-2;1-2;;;;/h1-2H2;2H,1H3;1H2;2*1H;/q;-1;;;;+2/p-2.
What are the key properties of dichloro(methylidene)ruthenium;methylazanide;propa-1,2-diene?
dichloro(methylidene)ruthenium;methylazanide;propa-1,2-diene has a molecular weight of 256.12 g/mol, XLogP of 2.97, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro(methylidene)ruthenium;methylazanide;propa-1,2-diene is sourced from PubChem (CID 156682049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).