About CID 156682067
CID 156682067 (PubChem CID 156682067) has the molecular formula C28H31N3O
and a molecular weight of 425.58 g/mol.
Molecular Properties
| Compound Name | CID 156682067 |
| PubChem CID | 156682067 |
| Molecular Formula | C28H31N3O |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1N1[C]N(c2ccccc2OCCc2ccccn2)C=C1 |
| InChI | InChI=1S/C28H31N3O/c1-21(2)24-11-9-12-25(22(3)4)28(24)31-18-17-30(20-31)26-13-5-6-14-27(26)32-19-15-23-10-7-8-16-29-23/h5-14,16-18,21-22H,15,19H2,1-4H3 |
| InChIKey | VDMRGPDINUTBCK-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 156682067 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156682067?
The IUPAC name of CID 156682067 (CID 156682067) is not available.
What is the SMILES notation for CID 156682067?
The canonical SMILES for CID 156682067 is CC(C)c1cccc(C(C)C)c1N1[C]N(c2ccccc2OCCc2ccccn2)C=C1.
What is the InChIKey of CID 156682067?
The InChIKey is VDMRGPDINUTBCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H31N3O/c1-21(2)24-11-9-12-25(22(3)4)28(24)31-18-17-30(20-31)26-13-5-6-14-27(26)32-19-15-23-10-7-8-16-29-23/h5-14,16-18,21-22H,15,19H2,1-4H3.
What are the key properties of CID 156682067?
CID 156682067 has a molecular weight of 425.58 g/mol, XLogP of 6.74, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156682067 is sourced from PubChem (CID 156682067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).