About CID 139239572
CID 139239572 (PubChem CID 139239572) has the molecular formula C37H46Cl2N4Pd
and a molecular weight of 724.13 g/mol.
Molecular Properties
| Compound Name | CID 139239572 |
| PubChem CID | 139239572 |
| Molecular Formula | C37H46Cl2N4Pd |
| Molecular Weight | 724.13 g/mol |
| Exact Mass | 722.21 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1N1[C]N(c2c(C(C)C)cccc2C(C)C)C=C1.Cl[Pd]Cl.c1ccc(Cn2ccnc2)cc1 |
| InChI | InChI=1S/C27H36N2.C10H10N2.2ClH.Pd/c1-18(2)22-11-9-12-23(19(3)4)26(22)28-15-16-29(17-28)27-24(20(5)6)13-10-14-25(27)21(7)8;1-2-4-10(5-3-1)8-12-7-6-11-9-12;;;/h9-16,18-21H,1-8H3;1-7,9H,8H2;2*1H;/q;;;;+2/p-2 |
| InChIKey | MSUHKMAZCAIASF-UHFFFAOYSA-L |
| XLogP | 11.28 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 724.13 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 139239572 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139239572?
The IUPAC name of CID 139239572 (CID 139239572) is not available.
What is the SMILES notation for CID 139239572?
The canonical SMILES for CID 139239572 is CC(C)c1cccc(C(C)C)c1N1[C]N(c2c(C(C)C)cccc2C(C)C)C=C1.Cl[Pd]Cl.c1ccc(Cn2ccnc2)cc1.
What is the InChIKey of CID 139239572?
The InChIKey is MSUHKMAZCAIASF-UHFFFAOYSA-L. The full InChI is InChI=1S/C27H36N2.C10H10N2.2ClH.Pd/c1-18(2)22-11-9-12-23(19(3)4)26(22)28-15-16-29(17-28)27-24(20(5)6)13-10-14-25(27)21(7)8;1-2-4-10(5-3-1)8-12-7-6-11-9-12;;;/h9-16,18-21H,1-8H3;1-7,9H,8H2;2*1H;/q;;;;+2/p-2.
What are the key properties of CID 139239572?
CID 139239572 has a molecular weight of 724.13 g/mol, XLogP of 11.28, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139239572 is sourced from PubChem (CID 139239572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).