C37H25NS — CID 156683739
N-(5,6,7,8-tetradeuterio-9,9-diphenylfluoren-2-yl)dibenzothiophen-1-amine (PubChem CID 156683739) has the molecular formula C37H25NS and a molecular weight of 519.71 g/mol. Its IUPAC name is N-(5,6,7,8-tetradeuterio-9,9-diphenylfluoren-2-yl)dibenzothiophen-1-amine.
| Compound Name | N-(5,6,7,8-tetradeuterio-9,9-diphenylfluoren-2-yl)dibenzothiophen-1-amine |
|---|---|
| PubChem CID | 156683739 |
| Molecular Formula | C37H25NS |
| Molecular Weight | 519.71 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | N-(5,6,7,8-tetradeuterio-9,9-diphenylfluoren-2-yl)dibenzothiophen-1-amine |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])-c1ccc(Nc3cccc4sc5ccccc5c34)cc1C2(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H25NS/c1-3-12-25(13-4-1)37(26-14-5-2-6-15-26)31-18-9-7-16-28(31)29-23-22-27(24-32(29)37)38-33-19-11-21-35-36(33)30-17-8-10-20-34(30)39-35/h1-24,38H/i7D,9D,16D,18D |
| InChIKey | DHCWCDBFBLJKDQ-LMAVZVLFSA-N |
| XLogP | 10.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.71 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |