C30H24FN5O — CID 156685386
(5aR,6R,9aS)-3-(3-fluorophenyl)-8-isocyano-6,9a-dimethyl-2-(3-pyrimidin-5-ylphenyl)-4,5,5a,6-tetrahydrobenzo[e]benzimidazol-7-one (PubChem CID 156685386) has the molecular formula C30H24FN5O and a molecular weight of 489.55 g/mol. Its IUPAC name is (5aR,6R,9aS)-3-(3-fluorophenyl)-8-isocyano-6,9a-dimethyl-2-(3-pyrimidin-5-ylphenyl)-4,5,5a,6-tetrahydrobenzo[e]benzimidazol-7-one.
| Compound Name | (5aR,6R,9aS)-3-(3-fluorophenyl)-8-isocyano-6,9a-dimethyl-2-(3-pyrimidin-5-ylphenyl)-4,5,5a,6-tetrahydrobenzo[e]benzimidazol-7-one |
|---|---|
| PubChem CID | 156685386 |
| Molecular Formula | C30H24FN5O |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | (5aR,6R,9aS)-3-(3-fluorophenyl)-8-isocyano-6,9a-dimethyl-2-(3-pyrimidin-5-ylphenyl)-4,5,5a,6-tetrahydrobenzo[e]benzimidazol-7-one |
| SMILES | [C-]#[N+]C1=C[C@@]2(C)c3nc(-c4cccc(-c5cncnc5)c4)n(-c4cccc(F)c4)c3CC[C@@H]2[C@@H](C)C1=O |
| InChI | InChI=1S/C30H24FN5O/c1-18-24-10-11-26-28(30(24,2)14-25(32-3)27(18)37)35-29(36(26)23-9-5-8-22(31)13-23)20-7-4-6-19(12-20)21-15-33-17-34-16-21/h4-9,12-18,24H,10-11H2,1-2H3/t18-,24-,30-/m1/s1 |
| InChIKey | CZGUKRMDKZUMPY-DDTSJLOESA-N |
| XLogP | 5.98 |
| TPSA | 65.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|