C29H23FN4O — CID 156685512
(5aR,6R,9aS)-3-(3-fluorophenyl)-8-isocyano-6,9a-dimethyl-2-quinolin-5-yl-4,5,5a,6-tetrahydrobenzo[e]benzimidazol-7-one (PubChem CID 156685512) has the molecular formula C29H23FN4O and a molecular weight of 462.53 g/mol. Its IUPAC name is (5aR,6R,9aS)-3-(3-fluorophenyl)-8-isocyano-6,9a-dimethyl-2-quinolin-5-yl-4,5,5a,6-tetrahydrobenzo[e]benzimidazol-7-one.
| Compound Name | (5aR,6R,9aS)-3-(3-fluorophenyl)-8-isocyano-6,9a-dimethyl-2-quinolin-5-yl-4,5,5a,6-tetrahydrobenzo[e]benzimidazol-7-one |
|---|---|
| PubChem CID | 156685512 |
| Molecular Formula | C29H23FN4O |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | (5aR,6R,9aS)-3-(3-fluorophenyl)-8-isocyano-6,9a-dimethyl-2-quinolin-5-yl-4,5,5a,6-tetrahydrobenzo[e]benzimidazol-7-one |
| SMILES | [C-]#[N+]C1=C[C@@]2(C)c3nc(-c4cccc5ncccc45)n(-c4cccc(F)c4)c3CC[C@@H]2[C@@H](C)C1=O |
| InChI | InChI=1S/C29H23FN4O/c1-17-22-12-13-25-27(29(22,2)16-24(31-3)26(17)35)33-28(34(25)19-8-4-7-18(30)15-19)21-9-5-11-23-20(21)10-6-14-32-23/h4-11,14-17,22H,12-13H2,1-2H3/t17-,22-,29-/m1/s1 |
| InChIKey | CWPZAKHUITZRKY-UEGGZXHXSA-N |
| XLogP | 6.07 |
| TPSA | 52.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|