C36H23F3N2O5S — CID 156685566
4-[3-[1-[4-(difluoromethyl)phenyl]sulfonyl-5-fluoro-3-(2-isocyanophenyl)indol-2-yl]phenyl]-3-methoxybenzoic acid (PubChem CID 156685566) has the molecular formula C36H23F3N2O5S and a molecular weight of 652.65 g/mol. Its IUPAC name is 4-[3-[1-[4-(difluoromethyl)phenyl]sulfonyl-5-fluoro-3-(2-isocyanophenyl)indol-2-yl]phenyl]-3-methoxybenzoic acid.
| Compound Name | 4-[3-[1-[4-(difluoromethyl)phenyl]sulfonyl-5-fluoro-3-(2-isocyanophenyl)indol-2-yl]phenyl]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 156685566 |
| Molecular Formula | C36H23F3N2O5S |
| Molecular Weight | 652.65 g/mol |
| Exact Mass | 652.13 |
| IUPAC Name | 4-[3-[1-[4-(difluoromethyl)phenyl]sulfonyl-5-fluoro-3-(2-isocyanophenyl)indol-2-yl]phenyl]-3-methoxybenzoic acid |
| SMILES | [C-]#[N+]c1ccccc1-c1c(-c2cccc(-c3ccc(C(=O)O)cc3OC)c2)n(S(=O)(=O)c2ccc(C(F)F)cc2)c2ccc(F)cc12 |
| InChI | InChI=1S/C36H23F3N2O5S/c1-40-30-9-4-3-8-28(30)33-29-20-25(37)13-17-31(29)41(47(44,45)26-14-10-21(11-15-26)35(38)39)34(33)23-7-5-6-22(18-23)27-16-12-24(36(42)43)19-32(27)46-2/h3-20,35H,2H3,(H,42,43) |
| InChIKey | OPMRTQQUZPSHQZ-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 89.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.65 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|