C24H20FNO6S — CID 11271341
ethyl 4-acetyloxy-6-fluoro-9-(4-methylphenyl)sulfonylcarbazole-2-carboxylate (PubChem CID 11271341) has the molecular formula C24H20FNO6S and a molecular weight of 469.49 g/mol. Its IUPAC name is ethyl 4-acetyloxy-6-fluoro-9-(4-methylphenyl)sulfonylcarbazole-2-carboxylate.
| Compound Name | ethyl 4-acetyloxy-6-fluoro-9-(4-methylphenyl)sulfonylcarbazole-2-carboxylate |
|---|---|
| PubChem CID | 11271341 |
| Molecular Formula | C24H20FNO6S |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | ethyl 4-acetyloxy-6-fluoro-9-(4-methylphenyl)sulfonylcarbazole-2-carboxylate |
| SMILES | CCOC(=O)c1cc(OC(C)=O)c2c3cc(F)ccc3n(S(=O)(=O)c3ccc(C)cc3)c2c1 |
| InChI | InChI=1S/C24H20FNO6S/c1-4-31-24(28)16-11-21-23(22(12-16)32-15(3)27)19-13-17(25)7-10-20(19)26(21)33(29,30)18-8-5-14(2)6-9-18/h5-13H,4H2,1-3H3 |
| InChIKey | BBVBFYDWFWWNCE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 91.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|