C21H17N3O2S2 — CID 156685618
tert-butyl 3-(2-isocyanothiophen-3-yl)-2-(1,3-thiazol-5-yl)indole-1-carboxylate (PubChem CID 156685618) has the molecular formula C21H17N3O2S2 and a molecular weight of 407.52 g/mol. Its IUPAC name is tert-butyl 3-(2-isocyanothiophen-3-yl)-2-(1,3-thiazol-5-yl)indole-1-carboxylate.
| Compound Name | tert-butyl 3-(2-isocyanothiophen-3-yl)-2-(1,3-thiazol-5-yl)indole-1-carboxylate |
|---|---|
| PubChem CID | 156685618 |
| Molecular Formula | C21H17N3O2S2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | tert-butyl 3-(2-isocyanothiophen-3-yl)-2-(1,3-thiazol-5-yl)indole-1-carboxylate |
| SMILES | [C-]#[N+]c1sccc1-c1c(-c2cncs2)n(C(=O)OC(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C21H17N3O2S2/c1-21(2,3)26-20(25)24-15-8-6-5-7-13(15)17(14-9-10-27-19(14)22-4)18(24)16-11-23-12-28-16/h5-12H,1-3H3 |
| InChIKey | LEXRZPWZOXPASL-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 48.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|