C16H28 — CID 156686010
4,9-di(propan-2-yl)tricyclo[5.3.0.02,6]decane (PubChem CID 156686010) has the molecular formula C16H28 and a molecular weight of 220.40 g/mol. Its IUPAC name is 4,9-di(propan-2-yl)tricyclo[5.3.0.02,6]decane.
| Compound Name | 4,9-di(propan-2-yl)tricyclo[5.3.0.02,6]decane |
|---|---|
| PubChem CID | 156686010 |
| Molecular Formula | C16H28 |
| Molecular Weight | 220.40 g/mol |
| Exact Mass | 220.22 |
| IUPAC Name | 4,9-di(propan-2-yl)tricyclo[5.3.0.02,6]decane |
| SMILES | CC(C)C1CC2C(C1)C1CC(C(C)C)CC21 |
| InChI | InChI=1S/C16H28/c1-9(2)11-5-13-14(6-11)16-8-12(10(3)4)7-15(13)16/h9-16H,5-8H2,1-4H3 |
| InChIKey | GWYUFJVJLNSBNH-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |