About spiro[1,2,4,5-tetrahydroindene-6,1'-cyclopropane]-1-yl acetate
spiro[1,2,4,5-tetrahydroindene-6,1'-cyclopropane]-1-yl acetate (PubChem CID 156687812) has the molecular formula C13H16O2
and a molecular weight of 204.27 g/mol. Its IUPAC name is spiro[1,2,4,5-tetrahydroindene-6,1'-cyclopropane]-1-yl acetate.
Analyze spiro[1,2,4,5-tetrahydroindene-6,1'-cyclopropane]-1-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,2,4,5-tetrahydroindene-6,1'-cyclopropane]-1-yl acetate?
The IUPAC name of spiro[1,2,4,5-tetrahydroindene-6,1'-cyclopropane]-1-yl acetate (CID 156687812) is spiro[1,2,4,5-tetrahydroindene-6,1'-cyclopropane]-1-yl acetate.
What is the SMILES notation for spiro[1,2,4,5-tetrahydroindene-6,1'-cyclopropane]-1-yl acetate?
The canonical SMILES for spiro[1,2,4,5-tetrahydroindene-6,1'-cyclopropane]-1-yl acetate is CC(=O)OC1CC=C2CCC3(C=C21)CC3.
What is the InChIKey of spiro[1,2,4,5-tetrahydroindene-6,1'-cyclopropane]-1-yl acetate?
The InChIKey is CYRFGVOIDIPEBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O2/c1-9(14)15-12-3-2-10-4-5-13(6-7-13)8-11(10)12/h2,8,12H,3-7H2,1H3.
What are the key properties of spiro[1,2,4,5-tetrahydroindene-6,1'-cyclopropane]-1-yl acetate?
spiro[1,2,4,5-tetrahydroindene-6,1'-cyclopropane]-1-yl acetate has a molecular weight of 204.27 g/mol, XLogP of 2.75, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,2,4,5-tetrahydroindene-6,1'-cyclopropane]-1-yl acetate is sourced from PubChem (CID 156687812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).