C13H13NO2 — CID 145095209
(2-pyridin-2-ylcyclohexa-2,4-dien-1-yl) acetate (PubChem CID 145095209) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is (2-pyridin-2-ylcyclohexa-2,4-dien-1-yl) acetate.
| Compound Name | (2-pyridin-2-ylcyclohexa-2,4-dien-1-yl) acetate |
|---|---|
| PubChem CID | 145095209 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | (2-pyridin-2-ylcyclohexa-2,4-dien-1-yl) acetate |
| SMILES | CC(=O)OC1CC=CC=C1c1ccccn1 |
| InChI | InChI=1S/C13H13NO2/c1-10(15)16-13-8-3-2-6-11(13)12-7-4-5-9-14-12/h2-7,9,13H,8H2,1H3 |
| InChIKey | XCKXWBLVVWWIDK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |