About cobalt(2+);3-deuterio-2-pyridin-2-ylpyridine;diacetate
cobalt(2+);3-deuterio-2-pyridin-2-ylpyridine;diacetate (PubChem CID 175778611) has the molecular formula C14H14CoN2O4
and a molecular weight of 334.22 g/mol. Its IUPAC name is cobalt(2+);3-deuterio-2-pyridin-2-ylpyridine;diacetate.
Molecular Properties
| Compound Name | cobalt(2+);3-deuterio-2-pyridin-2-ylpyridine;diacetate |
| PubChem CID | 175778611 |
| Molecular Formula | C14H14CoN2O4 |
| Molecular Weight | 334.22 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | cobalt(2+);3-deuterio-2-pyridin-2-ylpyridine;diacetate |
| SMILES | CC(=O)[O-].CC(=O)[O-].[2H]c1cccnc1-c1ccccn1.[Co+2] |
| InChI | InChI=1S/C10H8N2.2C2H4O2.Co/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;2*1-2(3)4;/h1-8H;2*1H3,(H,3,4);/q;;;+2/p-2/i5D;;; |
| InChIKey | BWAPRKDNRGCMOZ-IOAHNIEDSA-L |
| XLogP | -0.35 |
| TPSA | 106.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.22 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze cobalt(2+);3-deuterio-2-pyridin-2-ylpyridine;diacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt(2+);3-deuterio-2-pyridin-2-ylpyridine;diacetate?
The IUPAC name of cobalt(2+);3-deuterio-2-pyridin-2-ylpyridine;diacetate (CID 175778611) is cobalt(2+);3-deuterio-2-pyridin-2-ylpyridine;diacetate.
What is the SMILES notation for cobalt(2+);3-deuterio-2-pyridin-2-ylpyridine;diacetate?
The canonical SMILES for cobalt(2+);3-deuterio-2-pyridin-2-ylpyridine;diacetate is CC(=O)[O-].CC(=O)[O-].[2H]c1cccnc1-c1ccccn1.[Co+2].
What is the InChIKey of cobalt(2+);3-deuterio-2-pyridin-2-ylpyridine;diacetate?
The InChIKey is BWAPRKDNRGCMOZ-IOAHNIEDSA-L. The full InChI is InChI=1S/C10H8N2.2C2H4O2.Co/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;2*1-2(3)4;/h1-8H;2*1H3,(H,3,4);/q;;;+2/p-2/i5D;;;.
What are the key properties of cobalt(2+);3-deuterio-2-pyridin-2-ylpyridine;diacetate?
cobalt(2+);3-deuterio-2-pyridin-2-ylpyridine;diacetate has a molecular weight of 334.22 g/mol, XLogP of -0.35, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt(2+);3-deuterio-2-pyridin-2-ylpyridine;diacetate is sourced from PubChem (CID 175778611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).