C13H28O — CID 156689233
3-ethyl-2,5,6,6-tetramethylheptan-3-ol (PubChem CID 156689233) has the molecular formula C13H28O and a molecular weight of 200.37 g/mol. Its IUPAC name is 3-ethyl-2,5,6,6-tetramethylheptan-3-ol.
| Compound Name | 3-ethyl-2,5,6,6-tetramethylheptan-3-ol |
|---|---|
| PubChem CID | 156689233 |
| Molecular Formula | C13H28O |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.21 |
| IUPAC Name | 3-ethyl-2,5,6,6-tetramethylheptan-3-ol |
| SMILES | CCC(O)(CC(C)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C13H28O/c1-8-13(14,10(2)3)9-11(4)12(5,6)7/h10-11,14H,8-9H2,1-7H3 |
| InChIKey | NVPGGAWLHJBKCX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |