C22H44N2O4 — CID 23141081
N,N'-bis(4-ethyl-4-hydroxy-2,2-dimethylhexan-3-yl)oxamide (PubChem CID 23141081) has the molecular formula C22H44N2O4 and a molecular weight of 400.60 g/mol. Its IUPAC name is N,N'-bis(4-ethyl-4-hydroxy-2,2-dimethylhexan-3-yl)oxamide.
| Compound Name | N,N'-bis(4-ethyl-4-hydroxy-2,2-dimethylhexan-3-yl)oxamide |
|---|---|
| PubChem CID | 23141081 |
| Molecular Formula | C22H44N2O4 |
| Molecular Weight | 400.60 g/mol |
| Exact Mass | 400.33 |
| IUPAC Name | N,N'-bis(4-ethyl-4-hydroxy-2,2-dimethylhexan-3-yl)oxamide |
| SMILES | CCC(O)(CC)C(NC(=O)C(=O)NC(C(C)(C)C)C(O)(CC)CC)C(C)(C)C |
| InChI | InChI=1S/C22H44N2O4/c1-11-21(27,12-2)17(19(5,6)7)23-15(25)16(26)24-18(20(8,9)10)22(28,13-3)14-4/h17-18,27-28H,11-14H2,1-10H3,(H,23,25)(H,24,26) |
| InChIKey | NTYGFTPSRGUVLC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.60 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|