C17H34N2O4 — CID 87653467
N,N'-bis[(3R)-2-hydroxy-2,4-dimethylpentan-3-yl]propanediamide (PubChem CID 87653467) has the molecular formula C17H34N2O4 and a molecular weight of 330.47 g/mol. Its IUPAC name is N,N'-bis[(3R)-2-hydroxy-2,4-dimethylpentan-3-yl]propanediamide.
| Compound Name | N,N'-bis[(3R)-2-hydroxy-2,4-dimethylpentan-3-yl]propanediamide |
|---|---|
| PubChem CID | 87653467 |
| Molecular Formula | C17H34N2O4 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.25 |
| IUPAC Name | N,N'-bis[(3R)-2-hydroxy-2,4-dimethylpentan-3-yl]propanediamide |
| SMILES | CC(C)[C@@H](NC(=O)CC(=O)N[C@H](C(C)C)C(C)(C)O)C(C)(C)O |
| InChI | InChI=1S/C17H34N2O4/c1-10(2)14(16(5,6)22)18-12(20)9-13(21)19-15(11(3)4)17(7,8)23/h10-11,14-15,22-23H,9H2,1-8H3,(H,18,20)(H,19,21)/t14-,15-/m1/s1 |
| InChIKey | MMZCSYCELORDIW-HUUCEWRRSA-N |
| XLogP | 1.20 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|