C12H24N2O4 — CID 122022670
4-[[(3S)-2-hydroxy-2,4-dimethylpentan-3-yl]carbamoylamino]butanoic acid (PubChem CID 122022670) has the molecular formula C12H24N2O4 and a molecular weight of 260.33 g/mol. Its IUPAC name is 4-[[(3S)-2-hydroxy-2,4-dimethylpentan-3-yl]carbamoylamino]butanoic acid.
| Compound Name | 4-[[(3S)-2-hydroxy-2,4-dimethylpentan-3-yl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122022670 |
| Molecular Formula | C12H24N2O4 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 4-[[(3S)-2-hydroxy-2,4-dimethylpentan-3-yl]carbamoylamino]butanoic acid |
| SMILES | CC(C)[C@H](NC(=O)NCCCC(=O)O)C(C)(C)O |
| InChI | InChI=1S/C12H24N2O4/c1-8(2)10(12(3,4)18)14-11(17)13-7-5-6-9(15)16/h8,10,18H,5-7H2,1-4H3,(H,15,16)(H2,13,14,17)/t10-/m0/s1 |
| InChIKey | IJNIWWOKRUDEKW-JTQLQIEISA-N |
| XLogP | 0.95 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|