C21H42N2O4 — CID 87654322
N,N'-bis[(3R)-4-ethyl-4-hydroxy-2-methylhexan-3-yl]propanediamide (PubChem CID 87654322) has the molecular formula C21H42N2O4 and a molecular weight of 386.58 g/mol. Its IUPAC name is N,N'-bis[(3R)-4-ethyl-4-hydroxy-2-methylhexan-3-yl]propanediamide.
| Compound Name | N,N'-bis[(3R)-4-ethyl-4-hydroxy-2-methylhexan-3-yl]propanediamide |
|---|---|
| PubChem CID | 87654322 |
| Molecular Formula | C21H42N2O4 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.31 |
| IUPAC Name | N,N'-bis[(3R)-4-ethyl-4-hydroxy-2-methylhexan-3-yl]propanediamide |
| SMILES | CCC(O)(CC)[C@H](NC(=O)CC(=O)N[C@H](C(C)C)C(O)(CC)CC)C(C)C |
| InChI | InChI=1S/C21H42N2O4/c1-9-20(26,10-2)18(14(5)6)22-16(24)13-17(25)23-19(15(7)8)21(27,11-3)12-4/h14-15,18-19,26-27H,9-13H2,1-8H3,(H,22,24)(H,23,25)/t18-,19-/m1/s1 |
| InChIKey | VFEMPTQLHQEPQX-RTBURBONSA-N |
| XLogP | 2.76 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|