C21H16ClNSe — CID 156690104
N-(4-chlorophenyl)-N-(4-methylnaphthalen-1-yl)selenophen-2-amine (PubChem CID 156690104) has the molecular formula C21H16ClNSe and a molecular weight of 396.78 g/mol. Its IUPAC name is N-(4-chlorophenyl)-N-(4-methylnaphthalen-1-yl)selenophen-2-amine.
| Compound Name | N-(4-chlorophenyl)-N-(4-methylnaphthalen-1-yl)selenophen-2-amine |
|---|---|
| PubChem CID | 156690104 |
| Molecular Formula | C21H16ClNSe |
| Molecular Weight | 396.78 g/mol |
| Exact Mass | 397.01 |
| IUPAC Name | N-(4-chlorophenyl)-N-(4-methylnaphthalen-1-yl)selenophen-2-amine |
| SMILES | Cc1ccc(N(c2ccc(Cl)cc2)c2ccc[se]2)c2ccccc12 |
| InChI | InChI=1S/C21H16ClNSe/c1-15-8-13-20(19-6-3-2-5-18(15)19)23(21-7-4-14-24-21)17-11-9-16(22)10-12-17/h2-14H,1H3 |
| InChIKey | KLFJIEALJOLLLF-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.78 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|