C21H23N — CID 156692474
4-azapentacyclo[12.8.0.02,11.03,8.015,20]docosa-1(22),2,4,6,8,20-hexaene (PubChem CID 156692474) has the molecular formula C21H23N and a molecular weight of 289.42 g/mol. Its IUPAC name is 4-azapentacyclo[12.8.0.02,11.03,8.015,20]docosa-1(22),2,4,6,8,20-hexaene.
| Compound Name | 4-azapentacyclo[12.8.0.02,11.03,8.015,20]docosa-1(22),2,4,6,8,20-hexaene |
|---|---|
| PubChem CID | 156692474 |
| Molecular Formula | C21H23N |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 4-azapentacyclo[12.8.0.02,11.03,8.015,20]docosa-1(22),2,4,6,8,20-hexaene |
| SMILES | C1=C2CCCCC2C2CCC3CC=c4cccnc4=C3C2=C1 |
| InChI | InChI=1S/C21H23N/c1-2-6-17-14(4-1)9-12-19-18(17)11-10-15-7-8-16-5-3-13-22-21(16)20(15)19/h3,5,8-9,12-13,15,17-18H,1-2,4,6-7,10-11H2 |
| InChIKey | XBXGGQQRDQZJAU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |