C23H23N — CID 123636128
1-cyclohexa-1,3-dien-1-yl-1,4,4a,6a,10a,12a-hexahydronaphtho[2,1-f]isoquinoline (PubChem CID 123636128) has the molecular formula C23H23N and a molecular weight of 313.44 g/mol. Its IUPAC name is 1-cyclohexa-1,3-dien-1-yl-1,4,4a,6a,10a,12a-hexahydronaphtho[2,1-f]isoquinoline.
| Compound Name | 1-cyclohexa-1,3-dien-1-yl-1,4,4a,6a,10a,12a-hexahydronaphtho[2,1-f]isoquinoline |
|---|---|
| PubChem CID | 123636128 |
| Molecular Formula | C23H23N |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 1-cyclohexa-1,3-dien-1-yl-1,4,4a,6a,10a,12a-hexahydronaphtho[2,1-f]isoquinoline |
| SMILES | C1=CCCC(C2N=CCC3C4=C(C=CC32)C2C=CC=CC2C=C4)=C1 |
| InChI | InChI=1S/C23H23N/c1-2-7-17(8-3-1)23-22-13-12-19-18-9-5-4-6-16(18)10-11-20(19)21(22)14-15-24-23/h1-2,4-7,9-13,15-16,18,21-23H,3,8,14H2 |
| InChIKey | GIFZOGDIVBRXGA-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |