C21H21N — CID 139244160
(12cR,12dR)-12c,12d-dimethyl-2,7,11,12-tetrahydropyreno[5,4-c]pyridine (PubChem CID 139244160) has the molecular formula C21H21N and a molecular weight of 287.41 g/mol. Its IUPAC name is (12cR,12dR)-12c,12d-dimethyl-2,7,11,12-tetrahydropyreno[5,4-c]pyridine.
| Compound Name | (12cR,12dR)-12c,12d-dimethyl-2,7,11,12-tetrahydropyreno[5,4-c]pyridine |
|---|---|
| PubChem CID | 139244160 |
| Molecular Formula | C21H21N |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | (12cR,12dR)-12c,12d-dimethyl-2,7,11,12-tetrahydropyreno[5,4-c]pyridine |
| SMILES | C[C@@]12C3=CCC=C1C1=C(CCN=C1)C1=CCC=C(C=C3)[C@]12C |
| InChI | InChI=1S/C21H21N/c1-20-14-5-3-7-18(20)16-11-12-22-13-17(16)19-8-4-6-15(10-9-14)21(19,20)2/h5-10,13H,3-4,11-12H2,1-2H3/t20-,21-/m1/s1 |
| InChIKey | JKBCUOHAJXSIOK-NHCUHLMSSA-N |
| XLogP | 4.87 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |