C36H64N2O6Si4 — CID 156692649
2-[4-[4-[2-[bis(2-trimethylsilyloxyethyl)amino]-2-oxoethyl]phenyl]phenyl]-N,N-bis(2-trimethylsilyloxyethyl)acetamide (PubChem CID 156692649) has the molecular formula C36H64N2O6Si4 and a molecular weight of 733.26 g/mol. Its IUPAC name is 2-[4-[4-[2-[bis(2-trimethylsilyloxyethyl)amino]-2-oxoethyl]phenyl]phenyl]-N,N-bis(2-trimethylsilyloxyethyl)acetamide.
| Compound Name | 2-[4-[4-[2-[bis(2-trimethylsilyloxyethyl)amino]-2-oxoethyl]phenyl]phenyl]-N,N-bis(2-trimethylsilyloxyethyl)acetamide |
|---|---|
| PubChem CID | 156692649 |
| Molecular Formula | C36H64N2O6Si4 |
| Molecular Weight | 733.26 g/mol |
| Exact Mass | 732.38 |
| IUPAC Name | 2-[4-[4-[2-[bis(2-trimethylsilyloxyethyl)amino]-2-oxoethyl]phenyl]phenyl]-N,N-bis(2-trimethylsilyloxyethyl)acetamide |
| SMILES | C[Si](C)(C)OCCN(CCO[Si](C)(C)C)C(=O)Cc1ccc(-c2ccc(CC(=O)N(CCO[Si](C)(C)C)CCO[Si](C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C36H64N2O6Si4/c1-45(2,3)41-25-21-37(22-26-42-46(4,5)6)35(39)29-31-13-17-33(18-14-31)34-19-15-32(16-20-34)30-36(40)38(23-27-43-47(7,8)9)24-28-44-48(10,11)12/h13-20H,21-30H2,1-12H3 |
| InChIKey | BFCZNRHGTJSDCO-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.26 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|