C35H38Cl2N2O9 — CID 156693252
bis[5-(5-chloro-2-methoxy-4-methyl-3-pyridinyl)-2,3,4-trimethoxy-6-methylphenyl]methanone (PubChem CID 156693252) has the molecular formula C35H38Cl2N2O9 and a molecular weight of 701.60 g/mol. Its IUPAC name is bis[5-(5-chloro-2-methoxy-4-methyl-3-pyridinyl)-2,3,4-trimethoxy-6-methylphenyl]methanone.
| Compound Name | bis[5-(5-chloro-2-methoxy-4-methyl-3-pyridinyl)-2,3,4-trimethoxy-6-methylphenyl]methanone |
|---|---|
| PubChem CID | 156693252 |
| Molecular Formula | C35H38Cl2N2O9 |
| Molecular Weight | 701.60 g/mol |
| Exact Mass | 700.20 |
| IUPAC Name | bis[5-(5-chloro-2-methoxy-4-methyl-3-pyridinyl)-2,3,4-trimethoxy-6-methylphenyl]methanone |
| SMILES | COc1ncc(Cl)c(C)c1-c1c(C)c(C(=O)c2c(C)c(-c3c(OC)ncc(Cl)c3C)c(OC)c(OC)c2OC)c(OC)c(OC)c1OC |
| InChI | InChI=1S/C35H38Cl2N2O9/c1-15-19(36)13-38-34(47-11)23(15)21-17(3)25(30(43-7)32(45-9)28(21)41-5)27(40)26-18(4)22(29(42-6)33(46-10)31(26)44-8)24-16(2)20(37)14-39-35(24)48-12/h13-14H,1-12H3 |
| InChIKey | MXRGHULKFPLKHC-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 116.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.60 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |