2-(3,5-dichloro-2-methoxy-4-pyridinyl)acetic acid

C8H7Cl2NO3 — CID 121279026

IUPAC2-(3,5-dichloro-2-methoxy-4-pyridinyl)acetic acid
SMILESCOc1ncc(Cl)c(CC(=O)O)c1Cl
InChIInChI=1S/C8H7Cl2NO3/c1-14-8-7(10)4(2-6(12)13)5(9)3-11-8/h3H,2H2,1H3,(H,12,13)
InChIKeyUJRQVBVGNAXYCU-UHFFFAOYSA-N
MW236.05 g/mol
LogP2.02
Rot. Bonds3

About 2-(3,5-dichloro-2-methoxy-4-pyridinyl)acetic acid

2-(3,5-dichloro-2-methoxy-4-pyridinyl)acetic acid (PubChem CID 121279026) has the molecular formula C8H7Cl2NO3 and a molecular weight of 236.05 g/mol. Its IUPAC name is 2-(3,5-dichloro-2-methoxy-4-pyridinyl)acetic acid.

Molecular Properties

Compound Name2-(3,5-dichloro-2-methoxy-4-pyridinyl)acetic acid
PubChem CID121279026
Molecular FormulaC8H7Cl2NO3
Molecular Weight236.05 g/mol
Exact Mass234.98
IUPAC Name2-(3,5-dichloro-2-methoxy-4-pyridinyl)acetic acid
SMILESCOc1ncc(Cl)c(CC(=O)O)c1Cl
InChIInChI=1S/C8H7Cl2NO3/c1-14-8-7(10)4(2-6(12)13)5(9)3-11-8/h3H,2H2,1H3,(H,12,13)
InChIKeyUJRQVBVGNAXYCU-UHFFFAOYSA-N
XLogP2.02
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.05
LogP ≤ 52.02
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(3,5-dichloro-2-methoxy-4-pyridinyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,5-dichloro-2-methoxy-4-pyridinyl)acetic acid?
The IUPAC name of 2-(3,5-dichloro-2-methoxy-4-pyridinyl)acetic acid (CID 121279026) is 2-(3,5-dichloro-2-methoxy-4-pyridinyl)acetic acid.
What is the SMILES notation for 2-(3,5-dichloro-2-methoxy-4-pyridinyl)acetic acid?
The canonical SMILES for 2-(3,5-dichloro-2-methoxy-4-pyridinyl)acetic acid is COc1ncc(Cl)c(CC(=O)O)c1Cl.
What is the InChIKey of 2-(3,5-dichloro-2-methoxy-4-pyridinyl)acetic acid?
The InChIKey is UJRQVBVGNAXYCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7Cl2NO3/c1-14-8-7(10)4(2-6(12)13)5(9)3-11-8/h3H,2H2,1H3,(H,12,13).
What are the key properties of 2-(3,5-dichloro-2-methoxy-4-pyridinyl)acetic acid?
2-(3,5-dichloro-2-methoxy-4-pyridinyl)acetic acid has a molecular weight of 236.05 g/mol, XLogP of 2.02, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dichloro-2-methoxy-4-pyridinyl)acetic acid is sourced from PubChem (CID 121279026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).