C14H8Cl5NO3 — CID 134627185
2-[3-methoxy-5-(2,3,4,5,6-pentachlorophenyl)-4-pyridinyl]acetic acid (PubChem CID 134627185) has the molecular formula C14H8Cl5NO3 and a molecular weight of 415.49 g/mol. Its IUPAC name is 2-[3-methoxy-5-(2,3,4,5,6-pentachlorophenyl)-4-pyridinyl]acetic acid.
| Compound Name | 2-[3-methoxy-5-(2,3,4,5,6-pentachlorophenyl)-4-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 134627185 |
| Molecular Formula | C14H8Cl5NO3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 412.89 |
| IUPAC Name | 2-[3-methoxy-5-(2,3,4,5,6-pentachlorophenyl)-4-pyridinyl]acetic acid |
| SMILES | COc1cncc(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)c1CC(=O)O |
| InChI | InChI=1S/C14H8Cl5NO3/c1-23-7-4-20-3-6(5(7)2-8(21)22)9-10(15)12(17)14(19)13(18)11(9)16/h3-4H,2H2,1H3,(H,21,22) |
| InChIKey | YLEFACGBFVVRAB-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|