About methyl 2-[3,5-dichloro-2-(hydroxymethyl)-4-pyridinyl]acetate
methyl 2-[3,5-dichloro-2-(hydroxymethyl)-4-pyridinyl]acetate (PubChem CID 155467042) has the molecular formula C9H9Cl2NO3
and a molecular weight of 250.08 g/mol. Its IUPAC name is methyl 2-[3,5-dichloro-2-(hydroxymethyl)-4-pyridinyl]acetate.
Analyze methyl 2-[3,5-dichloro-2-(hydroxymethyl)-4-pyridinyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[3,5-dichloro-2-(hydroxymethyl)-4-pyridinyl]acetate?
The IUPAC name of methyl 2-[3,5-dichloro-2-(hydroxymethyl)-4-pyridinyl]acetate (CID 155467042) is methyl 2-[3,5-dichloro-2-(hydroxymethyl)-4-pyridinyl]acetate.
What is the SMILES notation for methyl 2-[3,5-dichloro-2-(hydroxymethyl)-4-pyridinyl]acetate?
The canonical SMILES for methyl 2-[3,5-dichloro-2-(hydroxymethyl)-4-pyridinyl]acetate is COC(=O)Cc1c(Cl)cnc(CO)c1Cl.
What is the InChIKey of methyl 2-[3,5-dichloro-2-(hydroxymethyl)-4-pyridinyl]acetate?
The InChIKey is VLGPTRJGVDEPLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9Cl2NO3/c1-15-8(14)2-5-6(10)3-12-7(4-13)9(5)11/h3,13H,2,4H2,1H3.
What are the key properties of methyl 2-[3,5-dichloro-2-(hydroxymethyl)-4-pyridinyl]acetate?
methyl 2-[3,5-dichloro-2-(hydroxymethyl)-4-pyridinyl]acetate has a molecular weight of 250.08 g/mol, XLogP of 1.60, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3,5-dichloro-2-(hydroxymethyl)-4-pyridinyl]acetate is sourced from PubChem (CID 155467042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).