About (3S,5R)-1-[(3-cyclopropylphenyl)methyl]-3,5-dimethylpiperazine
(3S,5R)-1-[(3-cyclopropylphenyl)methyl]-3,5-dimethylpiperazine (PubChem CID 156693653) has the molecular formula C16H24N2
and a molecular weight of 244.38 g/mol. Its IUPAC name is (3S,5R)-1-[(3-cyclopropylphenyl)methyl]-3,5-dimethylpiperazine.
Molecular Properties
| Compound Name | (3S,5R)-1-[(3-cyclopropylphenyl)methyl]-3,5-dimethylpiperazine |
| PubChem CID | 156693653 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | (3S,5R)-1-[(3-cyclopropylphenyl)methyl]-3,5-dimethylpiperazine |
| SMILES | C[C@@H]1CN(Cc2cccc(C3CC3)c2)C[C@H](C)N1 |
| InChI | InChI=1S/C16H24N2/c1-12-9-18(10-13(2)17-12)11-14-4-3-5-16(8-14)15-6-7-15/h3-5,8,12-13,15,17H,6-7,9-11H2,1-2H3/t12-,13+ |
| InChIKey | UBYOMFXGGMHKRX-BETUJISGSA-N |
| XLogP | 2.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S,5R)-1-[(3-cyclopropylphenyl)methyl]-3,5-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5R)-1-[(3-cyclopropylphenyl)methyl]-3,5-dimethylpiperazine?
The IUPAC name of (3S,5R)-1-[(3-cyclopropylphenyl)methyl]-3,5-dimethylpiperazine (CID 156693653) is (3S,5R)-1-[(3-cyclopropylphenyl)methyl]-3,5-dimethylpiperazine.
What is the SMILES notation for (3S,5R)-1-[(3-cyclopropylphenyl)methyl]-3,5-dimethylpiperazine?
The canonical SMILES for (3S,5R)-1-[(3-cyclopropylphenyl)methyl]-3,5-dimethylpiperazine is C[C@@H]1CN(Cc2cccc(C3CC3)c2)C[C@H](C)N1.
What is the InChIKey of (3S,5R)-1-[(3-cyclopropylphenyl)methyl]-3,5-dimethylpiperazine?
The InChIKey is UBYOMFXGGMHKRX-BETUJISGSA-N. The full InChI is InChI=1S/C16H24N2/c1-12-9-18(10-13(2)17-12)11-14-4-3-5-16(8-14)15-6-7-15/h3-5,8,12-13,15,17H,6-7,9-11H2,1-2H3/t12-,13+.
What are the key properties of (3S,5R)-1-[(3-cyclopropylphenyl)methyl]-3,5-dimethylpiperazine?
(3S,5R)-1-[(3-cyclopropylphenyl)methyl]-3,5-dimethylpiperazine has a molecular weight of 244.38 g/mol, XLogP of 2.75, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5R)-1-[(3-cyclopropylphenyl)methyl]-3,5-dimethylpiperazine is sourced from PubChem (CID 156693653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).