C16H24N2 — CID 156693653
(3S,5R)-1-[(3-cyclopropylphenyl)methyl]-3,5-dimethylpiperazine (PubChem CID 156693653) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is (3S,5R)-1-[(3-cyclopropylphenyl)methyl]-3,5-dimethylpiperazine.
| Compound Name | (3S,5R)-1-[(3-cyclopropylphenyl)methyl]-3,5-dimethylpiperazine |
|---|---|
| PubChem CID | 156693653 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | (3S,5R)-1-[(3-cyclopropylphenyl)methyl]-3,5-dimethylpiperazine |
| SMILES | C[C@@H]1CN(Cc2cccc(C3CC3)c2)C[C@H](C)N1 |
| InChI | InChI=1S/C16H24N2/c1-12-9-18(10-13(2)17-12)11-14-4-3-5-16(8-14)15-6-7-15/h3-5,8,12-13,15,17H,6-7,9-11H2,1-2H3/t12-,13+ |
| InChIKey | UBYOMFXGGMHKRX-BETUJISGSA-N |
| XLogP | 2.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |