About 4-cyclopropyl-2-[[(3S,5R)-3,5-dimethylpiperazin-1-yl]methyl]phenol
4-cyclopropyl-2-[[(3S,5R)-3,5-dimethylpiperazin-1-yl]methyl]phenol (PubChem CID 175933225) has the molecular formula C16H24N2O
and a molecular weight of 260.38 g/mol. Its IUPAC name is 4-cyclopropyl-2-[[(3S,5R)-3,5-dimethylpiperazin-1-yl]methyl]phenol.
Molecular Properties
| Compound Name | 4-cyclopropyl-2-[[(3S,5R)-3,5-dimethylpiperazin-1-yl]methyl]phenol |
| PubChem CID | 175933225 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 4-cyclopropyl-2-[[(3S,5R)-3,5-dimethylpiperazin-1-yl]methyl]phenol |
| SMILES | C[C@@H]1CN(Cc2cc(C3CC3)ccc2O)C[C@H](C)N1 |
| InChI | InChI=1S/C16H24N2O/c1-11-8-18(9-12(2)17-11)10-15-7-14(13-3-4-13)5-6-16(15)19/h5-7,11-13,17,19H,3-4,8-10H2,1-2H3/t11-,12+ |
| InChIKey | LBKLGBBPPVSGJJ-TXEJJXNPSA-N |
| XLogP | 2.45 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclopropyl-2-[[(3S,5R)-3,5-dimethylpiperazin-1-yl]methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropyl-2-[[(3S,5R)-3,5-dimethylpiperazin-1-yl]methyl]phenol?
The IUPAC name of 4-cyclopropyl-2-[[(3S,5R)-3,5-dimethylpiperazin-1-yl]methyl]phenol (CID 175933225) is 4-cyclopropyl-2-[[(3S,5R)-3,5-dimethylpiperazin-1-yl]methyl]phenol.
What is the SMILES notation for 4-cyclopropyl-2-[[(3S,5R)-3,5-dimethylpiperazin-1-yl]methyl]phenol?
The canonical SMILES for 4-cyclopropyl-2-[[(3S,5R)-3,5-dimethylpiperazin-1-yl]methyl]phenol is C[C@@H]1CN(Cc2cc(C3CC3)ccc2O)C[C@H](C)N1.
What is the InChIKey of 4-cyclopropyl-2-[[(3S,5R)-3,5-dimethylpiperazin-1-yl]methyl]phenol?
The InChIKey is LBKLGBBPPVSGJJ-TXEJJXNPSA-N. The full InChI is InChI=1S/C16H24N2O/c1-11-8-18(9-12(2)17-11)10-15-7-14(13-3-4-13)5-6-16(15)19/h5-7,11-13,17,19H,3-4,8-10H2,1-2H3/t11-,12+.
What are the key properties of 4-cyclopropyl-2-[[(3S,5R)-3,5-dimethylpiperazin-1-yl]methyl]phenol?
4-cyclopropyl-2-[[(3S,5R)-3,5-dimethylpiperazin-1-yl]methyl]phenol has a molecular weight of 260.38 g/mol, XLogP of 2.45, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropyl-2-[[(3S,5R)-3,5-dimethylpiperazin-1-yl]methyl]phenol is sourced from PubChem (CID 175933225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).