C13H14F3LiN4O — CID 156693783
lithium 1-[2-(2H-tetrazol-5-yl)-4-(trifluoromethyl)phenyl]pentan-1-olate (PubChem CID 156693783) has the molecular formula C13H14F3LiN4O and a molecular weight of 306.22 g/mol. Its IUPAC name is lithium 1-[2-(2H-tetrazol-5-yl)-4-(trifluoromethyl)phenyl]pentan-1-olate.
| Compound Name | lithium 1-[2-(2H-tetrazol-5-yl)-4-(trifluoromethyl)phenyl]pentan-1-olate |
|---|---|
| PubChem CID | 156693783 |
| Molecular Formula | C13H14F3LiN4O |
| Molecular Weight | 306.22 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | lithium 1-[2-(2H-tetrazol-5-yl)-4-(trifluoromethyl)phenyl]pentan-1-olate |
| SMILES | CCCCC([O-])c1ccc(C(F)(F)F)cc1-c1nn[nH]n1.[Li+] |
| InChI | InChI=1S/C13H14F3N4O.Li/c1-2-3-4-11(21)9-6-5-8(13(14,15)16)7-10(9)12-17-19-20-18-12;/h5-7,11H,2-4H2,1H3,(H,17,18,19,20);/q-1;+1 |
| InChIKey | RLXBNWHEGZDLIQ-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.22 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |