C21H27N5O2 — CID 156694058
N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-3-pyrazin-2-yl-3,4-diazatetracyclo[6.3.1.01,8.02,6]dodeca-2(6),4-diene-5-carboxamide (PubChem CID 156694058) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-3-pyrazin-2-yl-3,4-diazatetracyclo[6.3.1.01,8.02,6]dodeca-2(6),4-diene-5-carboxamide.
| Compound Name | N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-3-pyrazin-2-yl-3,4-diazatetracyclo[6.3.1.01,8.02,6]dodeca-2(6),4-diene-5-carboxamide |
|---|---|
| PubChem CID | 156694058 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-3-pyrazin-2-yl-3,4-diazatetracyclo[6.3.1.01,8.02,6]dodeca-2(6),4-diene-5-carboxamide |
| SMILES | CC(C)(C)[C@@H](CO)NC(=O)c1nn(-c2cnccn2)c2c1CC13CCCC21C3 |
| InChI | InChI=1S/C21H27N5O2/c1-19(2,3)14(11-27)24-18(28)16-13-9-20-5-4-6-21(20,12-20)17(13)26(25-16)15-10-22-7-8-23-15/h7-8,10,14,27H,4-6,9,11-12H2,1-3H3,(H,24,28)/t14-,20?,21?/m1/s1 |
| InChIKey | LJFZKAGHKMQRMW-OZJRSANCSA-N |
| XLogP | 2.17 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |