C21H27N5O3 — CID 175350763
N-(1-hydroxy-3,3-dimethylbutan-2-yl)-3-(4-oxidopyrazin-4-ium-2-yl)-3,4-diazatetracyclo[6.3.1.01,8.02,6]dodeca-2(6),4-diene-5-carboxamide (PubChem CID 175350763) has the molecular formula C21H27N5O3 and a molecular weight of 397.48 g/mol. Its IUPAC name is N-(1-hydroxy-3,3-dimethylbutan-2-yl)-3-(4-oxidopyrazin-4-ium-2-yl)-3,4-diazatetracyclo[6.3.1.01,8.02,6]dodeca-2(6),4-diene-5-carboxamide.
| Compound Name | N-(1-hydroxy-3,3-dimethylbutan-2-yl)-3-(4-oxidopyrazin-4-ium-2-yl)-3,4-diazatetracyclo[6.3.1.01,8.02,6]dodeca-2(6),4-diene-5-carboxamide |
|---|---|
| PubChem CID | 175350763 |
| Molecular Formula | C21H27N5O3 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | N-(1-hydroxy-3,3-dimethylbutan-2-yl)-3-(4-oxidopyrazin-4-ium-2-yl)-3,4-diazatetracyclo[6.3.1.01,8.02,6]dodeca-2(6),4-diene-5-carboxamide |
| SMILES | CC(C)(C)C(CO)NC(=O)c1nn(-c2c[n+]([O-])ccn2)c2c1CC13CCCC21C3 |
| InChI | InChI=1S/C21H27N5O3/c1-19(2,3)14(11-27)23-18(28)16-13-9-20-5-4-6-21(20,12-20)17(13)26(24-16)15-10-25(29)8-7-22-15/h7-8,10,14,27H,4-6,9,11-12H2,1-3H3,(H,23,28) |
| InChIKey | NVBOYGBCLUJDLW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|