C21H26N6O3 — CID 175095431
(4aS)-4a-cyano-N-(1-hydroxy-3,3-dimethylbutan-2-yl)-1-(4-oxidopyrazin-4-ium-2-yl)-5,6,7,7a-tetrahydro-4H-pentaleno[2,1-d]pyrazole-3-carboxamide (PubChem CID 175095431) has the molecular formula C21H26N6O3 and a molecular weight of 410.48 g/mol. Its IUPAC name is (4aS)-4a-cyano-N-(1-hydroxy-3,3-dimethylbutan-2-yl)-1-(4-oxidopyrazin-4-ium-2-yl)-5,6,7,7a-tetrahydro-4H-pentaleno[2,1-d]pyrazole-3-carboxamide.
| Compound Name | (4aS)-4a-cyano-N-(1-hydroxy-3,3-dimethylbutan-2-yl)-1-(4-oxidopyrazin-4-ium-2-yl)-5,6,7,7a-tetrahydro-4H-pentaleno[2,1-d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 175095431 |
| Molecular Formula | C21H26N6O3 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | (4aS)-4a-cyano-N-(1-hydroxy-3,3-dimethylbutan-2-yl)-1-(4-oxidopyrazin-4-ium-2-yl)-5,6,7,7a-tetrahydro-4H-pentaleno[2,1-d]pyrazole-3-carboxamide |
| SMILES | CC(C)(C)C(CO)NC(=O)c1nn(-c2c[n+]([O-])ccn2)c2c1C[C@@]1(C#N)CCCC21 |
| InChI | InChI=1S/C21H26N6O3/c1-20(2,3)15(11-28)24-19(29)17-13-9-21(12-22)6-4-5-14(21)18(13)27(25-17)16-10-26(30)8-7-23-16/h7-8,10,14-15,28H,4-6,9,11H2,1-3H3,(H,24,29)/t14?,15?,21-/m1/s1 |
| InChIKey | UEEIXQQXBKTPTC-ZGDBYOLNSA-N |
| XLogP | 1.37 |
| TPSA | 130.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|