C22H24F3N3O4 — CID 156694681
ethyl 6-[(2S)-2-[methoxy(methyl)carbamoyl]-4-[4-(trifluoromethyl)phenyl]pyrrolidin-1-yl]pyridine-3-carboxylate (PubChem CID 156694681) has the molecular formula C22H24F3N3O4 and a molecular weight of 451.45 g/mol. Its IUPAC name is ethyl 6-[(2S)-2-[methoxy(methyl)carbamoyl]-4-[4-(trifluoromethyl)phenyl]pyrrolidin-1-yl]pyridine-3-carboxylate.
| Compound Name | ethyl 6-[(2S)-2-[methoxy(methyl)carbamoyl]-4-[4-(trifluoromethyl)phenyl]pyrrolidin-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 156694681 |
| Molecular Formula | C22H24F3N3O4 |
| Molecular Weight | 451.45 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | ethyl 6-[(2S)-2-[methoxy(methyl)carbamoyl]-4-[4-(trifluoromethyl)phenyl]pyrrolidin-1-yl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(N2CC(c3ccc(C(F)(F)F)cc3)C[C@H]2C(=O)N(C)OC)nc1 |
| InChI | InChI=1S/C22H24F3N3O4/c1-4-32-21(30)15-7-10-19(26-12-15)28-13-16(11-18(28)20(29)27(2)31-3)14-5-8-17(9-6-14)22(23,24)25/h5-10,12,16,18H,4,11,13H2,1-3H3/t16?,18-/m0/s1 |
| InChIKey | WFSZXXKHAAOOJB-DAFXYXGESA-N |
| XLogP | 3.66 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|