C17H28N2O4 — CID 156694753
1-(oxan-2-yl)-3-[2-[2-(oxan-2-yloxy)ethoxy]ethyl]pyrazole (PubChem CID 156694753) has the molecular formula C17H28N2O4 and a molecular weight of 324.42 g/mol. Its IUPAC name is 1-(oxan-2-yl)-3-[2-[2-(oxan-2-yloxy)ethoxy]ethyl]pyrazole.
| Compound Name | 1-(oxan-2-yl)-3-[2-[2-(oxan-2-yloxy)ethoxy]ethyl]pyrazole |
|---|---|
| PubChem CID | 156694753 |
| Molecular Formula | C17H28N2O4 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 1-(oxan-2-yl)-3-[2-[2-(oxan-2-yloxy)ethoxy]ethyl]pyrazole |
| SMILES | c1cn(C2CCCCO2)nc1CCOCCOC1CCCCO1 |
| InChI | InChI=1S/C17H28N2O4/c1-3-10-21-16(5-1)19-9-7-15(18-19)8-12-20-13-14-23-17-6-2-4-11-22-17/h7,9,16-17H,1-6,8,10-14H2 |
| InChIKey | WWSXJGXLIHMJKT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 54.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|